![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| consumerinfo/ | 2024-11-15 17:27 | - | |
| brochures/ | 2024-10-29 08:30 | - | |
| employee_handbook/ | 2024-07-30 14:42 | - | |
| wasc/ | 2024-05-29 09:21 | - | |
| workshops/ | 2024-05-29 09:17 | - | |
| State Addenda_07.2020/ | 2024-05-29 09:17 | - | |
| BSN/ | 2024-05-29 09:13 | - | |
| imagegalleries/ | 2024-05-29 09:13 | - | |
| hyfn/ | 2024-05-29 09:10 | - | |
| docs/ | 2024-05-29 09:10 | - | |
| DH/ | 2024-05-29 09:10 | - | |
| ember/ | 2024-05-29 09:10 | - | |
| icon_programs/ | 2024-05-29 09:08 | - | |
| HCM/ | 2024-05-29 09:08 | - | |
| careerprofiles/ | 2024-05-29 09:08 | - | |
| applications/ | 2024-05-29 09:08 | - | |
| socialmediaswag/ | 2024-05-29 09:08 | - | |
| WSCUC/ | 2024-05-29 09:08 | - | |
| exhibits/ | 2024-05-29 09:08 | - | |
| IELocation/ | 2024-05-29 09:07 | - | |
| certificates/ | 2024-05-29 09:07 | - | |
| LocalChange/ | 2024-05-29 09:07 | - | |
| apps/ | 2024-05-29 09:07 | - | |
| 2019-20 Employee Ben..> | 2024-05-29 09:06 | 780K | |
| sjvc-logo-for-heerf-..> | 2024-05-29 09:06 | 15K | |
| Conflicts of Interes..> | 2024-05-29 09:06 | 21K | |
| The Mod Madness Edit..> | 2024-05-29 09:06 | 252K | |
| Exhibit 15 - Student..> | 2024-05-29 09:06 | 268K | |
| The-Best-Health-Care..> | 2024-05-29 09:06 | 5.1M | |
| sjvccoloredlogo.png | 2024-05-29 09:06 | 12K | |
| Fair Treatment and D..> | 2024-05-29 09:06 | 30K | |
| sjvc-star-banner2.gif | 2024-05-29 09:06 | 9.1K | |
| FERPA Policy.docx | 2024-05-29 09:06 | 26K | |
| Rest Breaks and Meal..> | 2024-05-29 09:06 | 14K | |
| sjvccoloredlogo.png_..> | 2024-05-29 09:06 | 4.3K | |
| Computers.Internet.E..> | 2024-05-29 09:06 | 48K | |
| Employee Referral Pr..> | 2024-05-29 09:06 | 22K | |
| Exhibit 14 - Dental ..> | 2024-05-29 09:06 | 4.3M | |
| Christmas-e-card.jpg | 2024-05-29 09:06 | 935K | |
| What-Does-a-Medical-..> | 2024-05-29 09:06 | 619K | |
| Employee_Referral_Pr..> | 2024-05-29 09:06 | 239K | |
| Where-can-business-a..> | 2024-05-29 09:06 | 6.7M | |
| Exhibit 12 - List of..> | 2024-05-29 09:06 | 849K | |
| Exhibit 7 - Faculty ..> | 2024-05-29 09:06 | 768K | |
| Fair Treatment and D..> | 2024-05-29 09:06 | 30K | |
| Exhibit 8 - San Dieg..> | 2024-05-29 09:06 | 230K | |
| Exhibit 5 - Timeline..> | 2024-05-29 09:06 | 16K | |
| Ember Education Secu..> | 2024-05-29 09:06 | 55K | |
| Remote Work-Final.docx | 2024-05-29 09:06 | 18K | |
| State Addenda_05.202..> | 2024-05-29 09:06 | 174K | |
| sjvc-blog-graphic.jpg | 2024-05-29 09:06 | 219K | |
| Sick Time Allotment...> | 2024-05-29 09:06 | 21K | |
| Exhibit 19 - Instruc..> | 2024-05-29 09:06 | 122K | |
| Exhibit 11 - Textboo..> | 2024-05-29 09:06 | 41K | |
| Alcohol and Drug Pre..> | 2024-05-29 09:06 | 370K | |
| Exhibit 9 - Floor pl..> | 2024-05-29 09:06 | 599K | |
| Exhibit 16 - Career ..> | 2024-05-29 09:06 | 38K | |
| The Mod Madness Edit..> | 2024-05-29 09:06 | 360K | |
| Exhibit 17 - Program..> | 2024-05-29 09:06 | 2.1M | |
| EH California Addend..> | 2024-05-29 09:06 | 209K | |
| Exhibit 6 - Governin..> | 2024-05-29 09:06 | 28K | |
| Carrington-sig.png | 2024-05-29 09:06 | 17K | |
| Exhibit 13 - List of..> | 2024-05-29 09:06 | 483K | |
| Employee Referral Pr..> | 2024-05-29 09:06 | 21K | |
| Carrington-bug-sig.png | 2024-05-29 09:06 | 14K | |
| Vacation Time Accrua..> | 2024-05-29 09:06 | 33K | |
| Code-of-Conduct-Fina..> | 2024-05-29 09:06 | 101K | |
| Blog-graphic-2.jpg | 2024-05-29 09:06 | 213K | |
| Employee Privacy Not..> | 2024-05-29 09:06 | 129K | |
| Carrington_Horizonta..> | 2024-05-29 09:06 | 8.2K | |
| Exhibit 12 - Dental ..> | 2024-05-29 09:06 | 460K | |
| Tuition Assistance P..> | 2024-05-29 09:06 | 26K | |
| Family and Medical L..> | 2024-05-29 09:06 | 19K | |
| Family and Medical L..> | 2024-05-29 09:06 | 19K | |
| Exhibit 4 - Sr. Mana..> | 2024-05-29 09:06 | 304K | |
| Ember-bug-sig.png | 2024-05-29 09:06 | 4.2K | |
| sjvc-logo-for-heerf-..> | 2024-05-29 09:06 | 36K | |
| Exhibit 18 - Dental ..> | 2024-05-29 09:06 | 4.4M | |
| Exhibit 2 - Mission ..> | 2024-05-29 09:06 | 13K | |
| Videoconferencing an..> | 2024-05-29 09:06 | 236K | |
| SJVC_eNSO_Checklist_..> | 2024-05-29 09:06 | 623K | |
| Exhibit 1 - Dental A..> | 2024-05-29 09:06 | 376K | |
| Telecom_Invoices_for..> | 2024-05-29 09:06 | 24M | |
| Social Media Accepta..> | 2024-05-29 09:06 | 38K | |
| sjvc-bug-sig.png | 2024-05-29 09:06 | 5.8K | |
| Exhibit 20 - Applica..> | 2024-05-29 09:06 | 11M | |
| 092719_Bethlehem_Cen..> | 2024-05-29 09:06 | 6.2M | |
| sjvc-star-banner.png | 2024-05-29 09:06 | 13K | |
| request-information.png | 2024-05-29 09:06 | 18K | |
| Personal Leave-Final..> | 2024-05-29 09:06 | 17K | |
| emberlogo-signature.png | 2024-05-29 09:06 | 12K | |
| SJVC-Logo-Email.png | 2024-05-29 09:06 | 9.8K | |
| Exhibit 10 - Equipme..> | 2024-05-29 09:06 | 265K | |
| Exhibit 3 - Feasibil..> | 2024-05-29 09:06 | 28K | |
| Transcript_Request_S..> | 2024-05-29 09:06 | 133K | |